C20H21N8O5S+ — CID 136817635
8-[(2E)-2-[[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethyl-5H-purin-9-ium-2,6-dione (PubChem CID 136817635) has the molecular formula C20H21N8O5S+ and a molecular weight of 485.51 g/mol. Its IUPAC name is 8-[(2E)-2-[[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethyl-5H-purin-9-ium-2,6-dione.
| Compound Name | 8-[(2E)-2-[[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethyl-5H-purin-9-ium-2,6-dione |
|---|---|
| PubChem CID | 136817635 |
| Molecular Formula | C20H21N8O5S+ |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 8-[(2E)-2-[[6-hydroxy-1-(4-methoxyphenyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethyl-5H-purin-9-ium-2,6-dione |
| SMILES | COc1ccc(-n2c(O)c(/C=N/NC3=[N+]=C4C(C(=O)N(C)C(=O)N4C)N3C)c(=O)[nH]c2=S)cc1 |
| InChI | InChI=1S/C20H20N8O5S/c1-25-13-14(26(2)20(32)27(3)17(13)31)22-18(25)24-21-9-12-15(29)23-19(34)28(16(12)30)10-5-7-11(33-4)8-6-10/h5-9,13H,1-4H3,(H2,21,23,29,30,34)/p+1 |
| InChIKey | RINJQQIXSFRZGM-UHFFFAOYSA-O |
| XLogP | -0.81 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|