C17H22N8O4S — CID 136817627
3-butyl-6-oxo-2-sulfanylidene-5-[(E)-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)hydrazinylidene]methyl]pyrimidin-4-olate (PubChem CID 136817627) has the molecular formula C17H22N8O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 3-butyl-6-oxo-2-sulfanylidene-5-[(E)-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)hydrazinylidene]methyl]pyrimidin-4-olate.
| Compound Name | 3-butyl-6-oxo-2-sulfanylidene-5-[(E)-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)hydrazinylidene]methyl]pyrimidin-4-olate |
|---|---|
| PubChem CID | 136817627 |
| Molecular Formula | C17H22N8O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-butyl-6-oxo-2-sulfanylidene-5-[(E)-[(1,3,7-trimethyl-2,6-dioxo-5H-purin-9-ium-8-yl)hydrazinylidene]methyl]pyrimidin-4-olate |
| SMILES | CCCCn1c([O-])c(/C=N/NC2=[N+]=C3C(C(=O)N(C)C(=O)N3C)N2C)c(=O)[nH]c1=S |
| InChI | InChI=1S/C17H22N8O4S/c1-5-6-7-25-13(27)9(12(26)20-16(25)30)8-18-21-15-19-11-10(22(15)2)14(28)24(4)17(29)23(11)3/h8,10H,5-7H2,1-4H3,(H2,18,20,26,27,30) |
| InChIKey | QIEWJWPHYBEMOU-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|