C21H20ClN6O3+ — CID 110210854
7-[(4-chlorophenyl)methyl]-8-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione (PubChem CID 110210854) has the molecular formula C21H20ClN6O3+ and a molecular weight of 439.88 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-8-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione.
| Compound Name | 7-[(4-chlorophenyl)methyl]-8-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione |
|---|---|
| PubChem CID | 110210854 |
| Molecular Formula | C21H20ClN6O3+ |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-8-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=[N+]=C(N/N=C/c3cccc(O)c3)N2Cc2ccc(Cl)cc2)N(C)C1=O |
| InChI | InChI=1S/C21H19ClN6O3/c1-26-18-17(19(30)27(2)21(26)31)28(12-13-6-8-15(22)9-7-13)20(24-18)25-23-11-14-4-3-5-16(29)10-14/h3-11,17,29H,12H2,1-2H3/p+1/b23-11+ |
| InChIKey | KNWCCTHGGCSIDG-FOKLQQMPSA-O |
| XLogP | 1.20 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|