C22H21BrClN6O4+ — CID 136817615
8-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-7-[(4-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione (PubChem CID 136817615) has the molecular formula C22H21BrClN6O4+ and a molecular weight of 548.81 g/mol. Its IUPAC name is 8-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-7-[(4-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione.
| Compound Name | 8-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-7-[(4-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione |
|---|---|
| PubChem CID | 136817615 |
| Molecular Formula | C22H21BrClN6O4+ |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | 8-[(2E)-2-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]hydrazinyl]-7-[(4-chlorophenyl)methyl]-1,3-dimethyl-5H-purin-9-ium-2,6-dione |
| SMILES | COc1cc(/C=N/NC2=[N+]=C3C(C(=O)N(C)C(=O)N3C)N2Cc2ccc(Cl)cc2)cc(Br)c1O |
| InChI | InChI=1S/C22H20BrClN6O4/c1-28-19-17(20(32)29(2)22(28)33)30(11-12-4-6-14(24)7-5-12)21(26-19)27-25-10-13-8-15(23)18(31)16(9-13)34-3/h4-10,17H,11H2,1-3H3,(H,25,31)/p+1 |
| InChIKey | LXCCFVYRLQBNET-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|