C14H15BrN2O5 — CID 1224382
5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 1224382) has the molecular formula C14H15BrN2O5 and a molecular weight of 371.19 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1224382 |
| Molecular Formula | C14H15BrN2O5 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(CC2C(=O)N(C)C(=O)N(C)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C14H15BrN2O5/c1-16-12(19)8(13(20)17(2)14(16)21)4-7-5-9(15)11(18)10(6-7)22-3/h5-6,8,18H,4H2,1-3H3 |
| InChIKey | ZHESTPXJUQJKBT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|