C9H9BrO4 — CID 519805
2-(3-bromo-4-hydroxy-5-methoxyphenyl)acetic acid (PubChem CID 519805) has the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. Its IUPAC name is 2-(3-bromo-4-hydroxy-5-methoxyphenyl)acetic acid.
| Compound Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 519805 |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | 2-(3-bromo-4-hydroxy-5-methoxyphenyl)acetic acid |
| SMILES | COc1cc(CC(=O)O)cc(Br)c1O |
| InChI | InChI=1S/C9H9BrO4/c1-14-7-3-5(4-8(11)12)2-6(10)9(7)13/h2-3,13H,4H2,1H3,(H,11,12) |
| InChIKey | RKJWTDZZELJFSC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |