C13H14N2O5S — CID 142730456
5-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 142730456) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 142730456 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-[(4-hydroxy-3,5-dimethoxyphenyl)methyl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(CC2C(=O)NC(=S)NC2=O)cc(OC)c1O |
| InChI | InChI=1S/C13H14N2O5S/c1-19-8-4-6(5-9(20-2)10(8)16)3-7-11(17)14-13(21)15-12(7)18/h4-5,7,16H,3H2,1-2H3,(H2,14,15,17,18,21) |
| InChIKey | FPYWPZOERPIOJQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|