About 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one
5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 82997070) has the molecular formula C11H11BrN2O3S
and a molecular weight of 331.19 g/mol. Its IUPAC name is 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| PubChem CID | 82997070 |
| Molecular Formula | C11H11BrN2O3S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc(Br)c(C2NC(=S)NC2=O)cc1OC |
| InChI | InChI=1S/C11H11BrN2O3S/c1-16-7-3-5(6(12)4-8(7)17-2)9-10(15)14-11(18)13-9/h3-4,9H,1-2H3,(H2,13,14,15,18) |
| InChIKey | UUMHDCXUKPOVBU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one?
The IUPAC name of 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (CID 82997070) is 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
What is the SMILES notation for 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one?
The canonical SMILES for 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one is COc1cc(Br)c(C2NC(=S)NC2=O)cc1OC.
What is the InChIKey of 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one?
The InChIKey is UUMHDCXUKPOVBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2O3S/c1-16-7-3-5(6(12)4-8(7)17-2)9-10(15)14-11(18)13-9/h3-4,9H,1-2H3,(H2,13,14,15,18).
What are the key properties of 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one?
5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one has a molecular weight of 331.19 g/mol, XLogP of 1.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-bromo-4,5-dimethoxyphenyl)-2-sulfanylideneimidazolidin-4-one is sourced from PubChem (CID 82997070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).