C12H10N2O4S — CID 10286132
4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]benzoic acid (PubChem CID 10286132) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]benzoic acid.
| Compound Name | 4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 10286132 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC2C(=O)NC(=S)NC2=O)cc1 |
| InChI | InChI=1S/C12H10N2O4S/c15-9-8(10(16)14-12(19)13-9)5-6-1-3-7(4-2-6)11(17)18/h1-4,8H,5H2,(H,17,18)(H2,13,14,15,16,19) |
| InChIKey | MELCMUHHGTVXAO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|