C16H14N2O5S — CID 118360993
4-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)methyl]benzenesulfonic acid (PubChem CID 118360993) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)methyl]benzenesulfonic acid.
| Compound Name | 4-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118360993 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-[(2,4-dioxo-1,5-dihydro-1,5-benzodiazepin-3-yl)methyl]benzenesulfonic acid |
| SMILES | O=C1Nc2ccccc2NC(=O)C1Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H14N2O5S/c19-15-12(9-10-5-7-11(8-6-10)24(21,22)23)16(20)18-14-4-2-1-3-13(14)17-15/h1-8,12H,9H2,(H,17,19)(H,18,20)(H,21,22,23) |
| InChIKey | DCYAWNNTVRIRNI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|