C17H17NO2 — CID 26367123
(3S)-3-[(4-ethoxyphenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 26367123) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (3S)-3-[(4-ethoxyphenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | (3S)-3-[(4-ethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 26367123 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3S)-3-[(4-ethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | CCOc1ccc(C[C@@H]2C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-2-20-13-9-7-12(8-10-13)11-15-14-5-3-4-6-16(14)18-17(15)19/h3-10,15H,2,11H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | RFORNQXGROOKTO-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |