C15H18N2O4 — CID 3125290
5-[(4-butoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 3125290) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-[(4-butoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-butoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3125290 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-[(4-butoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CCCCOc1ccc(CC2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H18N2O4/c1-2-3-8-21-11-6-4-10(5-7-11)9-12-13(18)16-15(20)17-14(12)19/h4-7,12H,2-3,8-9H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | MHURKNLSEGLSQQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|