C18H19NO2 — CID 51539527
(3R)-3-[(4-ethoxyphenyl)methyl]-5-methyl-1,3-dihydroindol-2-one (PubChem CID 51539527) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3R)-3-[(4-ethoxyphenyl)methyl]-5-methyl-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-[(4-ethoxyphenyl)methyl]-5-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 51539527 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3R)-3-[(4-ethoxyphenyl)methyl]-5-methyl-1,3-dihydroindol-2-one |
| SMILES | CCOc1ccc(C[C@H]2C(=O)Nc3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C18H19NO2/c1-3-21-14-7-5-13(6-8-14)11-16-15-10-12(2)4-9-17(15)19-18(16)20/h4-10,16H,3,11H2,1-2H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | MJXZKIZAUUAKKS-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |