C18H18BrNO3 — CID 43912764
5-bromo-3-[(4-ethoxy-3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 43912764) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is 5-bromo-3-[(4-ethoxy-3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-[(4-ethoxy-3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43912764 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-bromo-3-[(4-ethoxy-3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | CCOc1ccc(CC2C(=O)Nc3ccc(Br)cc32)cc1OC |
| InChI | InChI=1S/C18H18BrNO3/c1-3-23-16-7-4-11(9-17(16)22-2)8-14-13-10-12(19)5-6-15(13)20-18(14)21/h4-7,9-10,14H,3,8H2,1-2H3,(H,20,21) |
| InChIKey | WJMPZVXXMBVIET-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |