C20H21NO3 — CID 98140033
(3S)-3-[[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]methyl]-1,3-dihydroindol-2-one (PubChem CID 98140033) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (3S)-3-[[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]methyl]-1,3-dihydroindol-2-one.
| Compound Name | (3S)-3-[[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 98140033 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (3S)-3-[[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]methyl]-1,3-dihydroindol-2-one |
| SMILES | C=C(C)COc1ccc(C[C@@H]2C(=O)Nc3ccccc32)cc1OC |
| InChI | InChI=1S/C20H21NO3/c1-13(2)12-24-18-9-8-14(11-19(18)23-3)10-16-15-6-4-5-7-17(15)21-20(16)22/h4-9,11,16H,1,10,12H2,2-3H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | ULZRJSJDSSHRKY-INIZCTEOSA-N |
| XLogP | 3.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|