C20H22N2O3 — CID 54779970
2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-methyl-1,2-dihydroquinazolin-4-one (PubChem CID 54779970) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-methyl-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-methyl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 54779970 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[3-methoxy-4-(2-methylprop-2-enoxy)phenyl]-3-methyl-1,2-dihydroquinazolin-4-one |
| SMILES | C=C(C)COc1ccc(C2Nc3ccccc3C(=O)N2C)cc1OC |
| InChI | InChI=1S/C20H22N2O3/c1-13(2)12-25-17-10-9-14(11-18(17)24-4)19-21-16-8-6-5-7-15(16)20(23)22(19)3/h5-11,19,21H,1,12H2,2-4H3 |
| InChIKey | QZYXLRKFYQYESI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|