C16H15N2O4- — CID 3415932
2-(3,4-dimethoxyphenyl)-3-oxido-1,2-dihydroquinazolin-4-one (PubChem CID 3415932) has the molecular formula C16H15N2O4- and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-oxido-1,2-dihydroquinazolin-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-oxido-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 3415932 |
| Molecular Formula | C16H15N2O4- |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-oxido-1,2-dihydroquinazolin-4-one |
| SMILES | COc1ccc(C2Nc3ccccc3C(=O)N2[O-])cc1OC |
| InChI | InChI=1S/C16H15N2O4/c1-21-13-8-7-10(9-14(13)22-2)15-17-12-6-4-3-5-11(12)16(19)18(15)20/h3-9,15,17H,1-2H3/q-1 |
| InChIKey | GTUYTLCBSKDJNZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |