C17H16BrNO3 — CID 95059739
(3R)-3-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 95059739) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is (3R)-3-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | (3R)-3-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 95059739 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | (3R)-3-[(3-bromo-4,5-dimethoxyphenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | COc1cc(C[C@H]2C(=O)Nc3ccccc32)cc(Br)c1OC |
| InChI | InChI=1S/C17H16BrNO3/c1-21-15-9-10(8-13(18)16(15)22-2)7-12-11-5-3-4-6-14(11)19-17(12)20/h3-6,8-9,12H,7H2,1-2H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | VRNFEONMEFJOOW-GFCCVEGCSA-N |
| XLogP | 3.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |