C13H14N3NaO8S2 — CID 140651103
sodium 2-[[4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]phenyl]sulfonylamino]ethanesulfonate (PubChem CID 140651103) has the molecular formula C13H14N3NaO8S2 and a molecular weight of 427.39 g/mol. Its IUPAC name is sodium 2-[[4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]phenyl]sulfonylamino]ethanesulfonate.
| Compound Name | sodium 2-[[4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]phenyl]sulfonylamino]ethanesulfonate |
|---|---|
| PubChem CID | 140651103 |
| Molecular Formula | C13H14N3NaO8S2 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | sodium 2-[[4-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]phenyl]sulfonylamino]ethanesulfonate |
| SMILES | O=C1NC(=O)C(Cc2ccc(S(=O)(=O)NCCS(=O)(=O)[O-])cc2)C(=O)N1.[Na+] |
| InChI | InChI=1S/C13H15N3O8S2.Na/c17-11-10(12(18)16-13(19)15-11)7-8-1-3-9(4-2-8)26(23,24)14-5-6-25(20,21)22;/h1-4,10,14H,5-7H2,(H,20,21,22)(H2,15,16,17,18,19);/q;+1/p-1 |
| InChIKey | YLGGCYKDDAHKBE-UHFFFAOYSA-M |
| XLogP | -4.96 |
| TPSA | 178.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | -4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|