C16H26N2O3S — CID 28719184
N-(3-methoxypropyl)-4-(piperidin-4-ylmethyl)benzenesulfonamide (PubChem CID 28719184) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4-(piperidin-4-ylmethyl)benzenesulfonamide.
| Compound Name | N-(3-methoxypropyl)-4-(piperidin-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 28719184 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-(3-methoxypropyl)-4-(piperidin-4-ylmethyl)benzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(CC2CCNCC2)cc1 |
| InChI | InChI=1S/C16H26N2O3S/c1-21-12-2-9-18-22(19,20)16-5-3-14(4-6-16)13-15-7-10-17-11-8-15/h3-6,15,17-18H,2,7-13H2,1H3 |
| InChIKey | ANDYBFMMVGNNHS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|