C11H18N2O4S2 — CID 54935180
4-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide (PubChem CID 54935180) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 54935180 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-(methylaminomethyl)-N-(2-methylsulfonylethyl)benzenesulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H18N2O4S2/c1-12-9-10-3-5-11(6-4-10)19(16,17)13-7-8-18(2,14)15/h3-6,12-13H,7-9H2,1-2H3 |
| InChIKey | MLIDPKWKCTVKTP-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |