C11H16N2O4S3 — CID 79185811
2-[4-(2-methylsulfonylethylsulfamoyl)phenyl]ethanethioamide (PubChem CID 79185811) has the molecular formula C11H16N2O4S3 and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-[4-(2-methylsulfonylethylsulfamoyl)phenyl]ethanethioamide.
| Compound Name | 2-[4-(2-methylsulfonylethylsulfamoyl)phenyl]ethanethioamide |
|---|---|
| PubChem CID | 79185811 |
| Molecular Formula | C11H16N2O4S3 |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-[4-(2-methylsulfonylethylsulfamoyl)phenyl]ethanethioamide |
| SMILES | CS(=O)(=O)CCNS(=O)(=O)c1ccc(CC(N)=S)cc1 |
| InChI | InChI=1S/C11H16N2O4S3/c1-19(14,15)7-6-13-20(16,17)10-4-2-9(3-5-10)8-11(12)18/h2-5,13H,6-8H2,1H3,(H2,12,18) |
| InChIKey | KOALLDOHBRDOSL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|