C10H15N3O4S3 — CID 79185181
2-[4-(2-sulfamoylethylsulfamoyl)phenyl]ethanethioamide (PubChem CID 79185181) has the molecular formula C10H15N3O4S3 and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[4-(2-sulfamoylethylsulfamoyl)phenyl]ethanethioamide.
| Compound Name | 2-[4-(2-sulfamoylethylsulfamoyl)phenyl]ethanethioamide |
|---|---|
| PubChem CID | 79185181 |
| Molecular Formula | C10H15N3O4S3 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-[4-(2-sulfamoylethylsulfamoyl)phenyl]ethanethioamide |
| SMILES | NC(=S)Cc1ccc(S(=O)(=O)NCCS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15N3O4S3/c11-10(18)7-8-1-3-9(4-2-8)20(16,17)13-5-6-19(12,14)15/h1-4,13H,5-7H2,(H2,11,18)(H2,12,14,15) |
| InChIKey | MPDJUIPSVNYLED-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|