C9H13N3O4S3 — CID 43552526
3-(2-sulfamoylethylsulfamoyl)benzenecarbothioamide (PubChem CID 43552526) has the molecular formula C9H13N3O4S3 and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-(2-sulfamoylethylsulfamoyl)benzenecarbothioamide.
| Compound Name | 3-(2-sulfamoylethylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 43552526 |
| Molecular Formula | C9H13N3O4S3 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 3-(2-sulfamoylethylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(S(=O)(=O)NCCS(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H13N3O4S3/c10-9(17)7-2-1-3-8(6-7)19(15,16)12-4-5-18(11,13)14/h1-3,6,12H,4-5H2,(H2,10,17)(H2,11,13,14) |
| InChIKey | KIXPIAGLVUNBGV-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|