C11H15N3O4S2 — CID 106237183
2-[2-[(3-carbamothioylphenyl)sulfonylamino]ethoxy]acetamide (PubChem CID 106237183) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[2-[(3-carbamothioylphenyl)sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-carbamothioylphenyl)sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106237183 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-[2-[(3-carbamothioylphenyl)sulfonylamino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNS(=O)(=O)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C11H15N3O4S2/c12-10(15)7-18-5-4-14-20(16,17)9-3-1-2-8(6-9)11(13)19/h1-3,6,14H,4-5,7H2,(H2,12,15)(H2,13,19) |
| InChIKey | SUDPOZVZIFRXHX-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|