C10H13N3O3S2 — CID 43310617
2-[(3-carbamothioylphenyl)sulfonylamino]-N-methylacetamide (PubChem CID 43310617) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-[(3-carbamothioylphenyl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(3-carbamothioylphenyl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43310617 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[(3-carbamothioylphenyl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1cccc(C(N)=S)c1 |
| InChI | InChI=1S/C10H13N3O3S2/c1-12-9(14)6-13-18(15,16)8-4-2-3-7(5-8)10(11)17/h2-5,13H,6H2,1H3,(H2,11,17)(H,12,14) |
| InChIKey | OVNYPSIGYHTSTL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|