C12H12N2O6S — CID 90362083
(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)methanesulfonic acid (PubChem CID 90362083) has the molecular formula C12H12N2O6S and a molecular weight of 312.30 g/mol. Its IUPAC name is (5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)methanesulfonic acid.
| Compound Name | (5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)methanesulfonic acid |
|---|---|
| PubChem CID | 90362083 |
| Molecular Formula | C12H12N2O6S |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)methanesulfonic acid |
| SMILES | O=C1NC(=O)N(CS(=O)(=O)O)C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C12H12N2O6S/c15-10-9(6-8-4-2-1-3-5-8)11(16)14(12(17)13-10)7-21(18,19)20/h1-5,9H,6-7H2,(H,13,15,17)(H,18,19,20) |
| InChIKey | NCWCIWWWGVVJGO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|