C36H36N6O10 — CID 121432773
2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethyl N-[[3-[[2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethoxycarbonylamino]methyl]phenyl]methyl]carbamate (PubChem CID 121432773) has the molecular formula C36H36N6O10 and a molecular weight of 712.72 g/mol. Its IUPAC name is 2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethyl N-[[3-[[2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethoxycarbonylamino]methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethyl N-[[3-[[2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethoxycarbonylamino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 121432773 |
| Molecular Formula | C36H36N6O10 |
| Molecular Weight | 712.72 g/mol |
| Exact Mass | 712.25 |
| IUPAC Name | 2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethyl N-[[3-[[2-(5-benzyl-2,4,6-trioxo-1,3-diazinan-1-yl)ethoxycarbonylamino]methyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1cccc(CNC(=O)OCCN2C(=O)NC(=O)C(Cc3ccccc3)C2=O)c1)OCCN1C(=O)NC(=O)C(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C36H36N6O10/c43-29-27(19-23-8-3-1-4-9-23)31(45)41(33(47)39-29)14-16-51-35(49)37-21-25-12-7-13-26(18-25)22-38-36(50)52-17-15-42-32(46)28(30(44)40-34(42)48)20-24-10-5-2-6-11-24/h1-13,18,27-28H,14-17,19-22H2,(H,37,49)(H,38,50)(H,39,43,47)(H,40,44,48) |
| InChIKey | LQVTYNQKLBDMLI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 209.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.72 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|