C23H29N3O6 — CID 121431629
[3-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]-2-methylpropyl] N-benzylcarbamate (PubChem CID 121431629) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is [3-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]-2-methylpropyl] N-benzylcarbamate.
| Compound Name | [3-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]-2-methylpropyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 121431629 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | [3-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]-2-methylpropyl] N-benzylcarbamate |
| SMILES | COC(=O)NCc1cccc(CNC(=O)OCC(C)COC(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H29N3O6/c1-17(15-31-22(28)25-12-18-7-4-3-5-8-18)16-32-23(29)26-14-20-10-6-9-19(11-20)13-24-21(27)30-2/h3-11,17H,12-16H2,1-2H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | ZOUUFPJQPVSOSW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|