C16H23N3O6 — CID 118911894
1-(methylcarbamoyloxy)propan-2-yl N-[[3-[(methoxycarbonylamino)methyl]phenyl]methyl]carbamate (PubChem CID 118911894) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is 1-(methylcarbamoyloxy)propan-2-yl N-[[3-[(methoxycarbonylamino)methyl]phenyl]methyl]carbamate.
| Compound Name | 1-(methylcarbamoyloxy)propan-2-yl N-[[3-[(methoxycarbonylamino)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 118911894 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-(methylcarbamoyloxy)propan-2-yl N-[[3-[(methoxycarbonylamino)methyl]phenyl]methyl]carbamate |
| SMILES | CNC(=O)OCC(C)OC(=O)NCc1cccc(CNC(=O)OC)c1 |
| InChI | InChI=1S/C16H23N3O6/c1-11(10-24-14(20)17-2)25-16(22)19-9-13-6-4-5-12(7-13)8-18-15(21)23-3/h4-7,11H,8-10H2,1-3H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | MMRQFYWCGBOFSR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|