C10H13N3O3 — CID 150640545
methyl N-[[3-(carbamoylamino)phenyl]methyl]carbamate (PubChem CID 150640545) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl N-[[3-(carbamoylamino)phenyl]methyl]carbamate.
| Compound Name | methyl N-[[3-(carbamoylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 150640545 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | methyl N-[[3-(carbamoylamino)phenyl]methyl]carbamate |
| SMILES | COC(=O)NCc1cccc(NC(N)=O)c1 |
| InChI | InChI=1S/C10H13N3O3/c1-16-10(15)12-6-7-3-2-4-8(5-7)13-9(11)14/h2-5H,6H2,1H3,(H,12,15)(H3,11,13,14) |
| InChIKey | IZUQUFGLVGLUQL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |