C17H18ClN3O3 — CID 51090626
N-[[3-(carbamoylamino)phenyl]methyl]-2-[(2-chlorophenyl)methoxy]acetamide (PubChem CID 51090626) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is N-[[3-(carbamoylamino)phenyl]methyl]-2-[(2-chlorophenyl)methoxy]acetamide.
| Compound Name | N-[[3-(carbamoylamino)phenyl]methyl]-2-[(2-chlorophenyl)methoxy]acetamide |
|---|---|
| PubChem CID | 51090626 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[[3-(carbamoylamino)phenyl]methyl]-2-[(2-chlorophenyl)methoxy]acetamide |
| SMILES | NC(=O)Nc1cccc(CNC(=O)COCc2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H18ClN3O3/c18-15-7-2-1-5-13(15)10-24-11-16(22)20-9-12-4-3-6-14(8-12)21-17(19)23/h1-8H,9-11H2,(H,20,22)(H3,19,21,23) |
| InChIKey | SYUYNAWVICPDNA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |