C17H22N2O6 — CID 159926044
2-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]prop-2-enyl propanoate (PubChem CID 159926044) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]prop-2-enyl propanoate.
| Compound Name | 2-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]prop-2-enyl propanoate |
|---|---|
| PubChem CID | 159926044 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-[[3-[(methoxycarbonylamino)methyl]phenyl]methylcarbamoyloxy]prop-2-enyl propanoate |
| SMILES | C=C(COC(=O)CC)OC(=O)NCc1cccc(CNC(=O)OC)c1 |
| InChI | InChI=1S/C17H22N2O6/c1-4-15(20)24-11-12(2)25-17(22)19-10-14-7-5-6-13(8-14)9-18-16(21)23-3/h5-8H,2,4,9-11H2,1,3H3,(H,18,21)(H,19,22) |
| InChIKey | BIXPFQBUJIXLRI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|