C10H14N2O — CID 70298508
(3-ethylphenyl)methylurea (PubChem CID 70298508) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (3-ethylphenyl)methylurea.
| Compound Name | (3-ethylphenyl)methylurea |
|---|---|
| PubChem CID | 70298508 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (3-ethylphenyl)methylurea |
| SMILES | CCc1cccc(CNC(N)=O)c1 |
| InChI | InChI=1S/C10H14N2O/c1-2-8-4-3-5-9(6-8)7-12-10(11)13/h3-6H,2,7H2,1H3,(H3,11,12,13) |
| InChIKey | WBYFRFGEGSOXET-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |