C18H26N4O4 — CID 2901283
N'-[[3-[[[2-oxo-2-(propylamino)acetyl]amino]methyl]phenyl]methyl]-N-propyloxamide (PubChem CID 2901283) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is N'-[[3-[[[2-oxo-2-(propylamino)acetyl]amino]methyl]phenyl]methyl]-N-propyloxamide.
| Compound Name | N'-[[3-[[[2-oxo-2-(propylamino)acetyl]amino]methyl]phenyl]methyl]-N-propyloxamide |
|---|---|
| PubChem CID | 2901283 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N'-[[3-[[[2-oxo-2-(propylamino)acetyl]amino]methyl]phenyl]methyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NCc1cccc(CNC(=O)C(=O)NCCC)c1 |
| InChI | InChI=1S/C18H26N4O4/c1-3-8-19-15(23)17(25)21-11-13-6-5-7-14(10-13)12-22-18(26)16(24)20-9-4-2/h5-7,10H,3-4,8-9,11-12H2,1-2H3,(H,19,23)(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | UCWTZRUQMPOZNT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|