C19H22N2O2 — CID 108984715
N'-[(3-methylphenyl)methyl]-N-(3-phenylpropyl)oxamide (PubChem CID 108984715) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N'-[(3-methylphenyl)methyl]-N-(3-phenylpropyl)oxamide.
| Compound Name | N'-[(3-methylphenyl)methyl]-N-(3-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 108984715 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N'-[(3-methylphenyl)methyl]-N-(3-phenylpropyl)oxamide |
| SMILES | Cc1cccc(CNC(=O)C(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-15-7-5-10-17(13-15)14-21-19(23)18(22)20-12-6-11-16-8-3-2-4-9-16/h2-5,7-10,13H,6,11-12,14H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HECSSXSGNMLGIK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|