C24H25NO — CID 100516624
N-[3-(3-methylphenyl)propyl]-2-(4-phenylphenyl)acetamide (PubChem CID 100516624) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is N-[3-(3-methylphenyl)propyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[3-(3-methylphenyl)propyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 100516624 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[3-(3-methylphenyl)propyl]-2-(4-phenylphenyl)acetamide |
| SMILES | Cc1cccc(CCCNC(=O)Cc2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H25NO/c1-19-7-5-8-20(17-19)9-6-16-25-24(26)18-21-12-14-23(15-13-21)22-10-3-2-4-11-22/h2-5,7-8,10-15,17H,6,9,16,18H2,1H3,(H,25,26) |
| InChIKey | YNIMAYXUKZBEGQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|