C13H22N2O2 — CID 142192151
ethane;ethyl N-[[3-(aminomethyl)phenyl]methyl]carbamate (PubChem CID 142192151) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane;ethyl N-[[3-(aminomethyl)phenyl]methyl]carbamate.
| Compound Name | ethane;ethyl N-[[3-(aminomethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142192151 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | ethane;ethyl N-[[3-(aminomethyl)phenyl]methyl]carbamate |
| SMILES | CC.CCOC(=O)NCc1cccc(CN)c1 |
| InChI | InChI=1S/C11H16N2O2.C2H6/c1-2-15-11(14)13-8-10-5-3-4-9(6-10)7-12;1-2/h3-6H,2,7-8,12H2,1H3,(H,13,14);1-2H3 |
| InChIKey | HQKALINXNZQCGB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |