C34H34N4O8 — CID 10168111
dimethyl 2,5-bis[3-[[3-(aminomethyl)phenyl]methylcarbamoyloxy]prop-1-ynyl]benzene-1,4-dicarboxylate (PubChem CID 10168111) has the molecular formula C34H34N4O8 and a molecular weight of 626.67 g/mol. Its IUPAC name is dimethyl 2,5-bis[3-[[3-(aminomethyl)phenyl]methylcarbamoyloxy]prop-1-ynyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis[3-[[3-(aminomethyl)phenyl]methylcarbamoyloxy]prop-1-ynyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10168111 |
| Molecular Formula | C34H34N4O8 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | dimethyl 2,5-bis[3-[[3-(aminomethyl)phenyl]methylcarbamoyloxy]prop-1-ynyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C#CCOC(=O)NCc2cccc(CN)c2)c(C(=O)OC)cc1C#CCOC(=O)NCc1cccc(CN)c1 |
| InChI | InChI=1S/C34H34N4O8/c1-43-31(39)29-17-28(12-6-14-46-34(42)38-22-26-10-4-8-24(16-26)20-36)30(32(40)44-2)18-27(29)11-5-13-45-33(41)37-21-25-9-3-7-23(15-25)19-35/h3-4,7-10,15-18H,13-14,19-22,35-36H2,1-2H3,(H,37,41)(H,38,42) |
| InChIKey | LQAJXGILJCMHAF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 181.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|