C34H38N4O6 — CID 22058391
tert-butyl carbamate;3-[6-[3-[(3-methylphenyl)methylcarbamoyloxy]prop-1-ynyl]-2-pyridinyl]prop-2-ynyl N-[(3-methylphenyl)methyl]carbamate (PubChem CID 22058391) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is tert-butyl carbamate;3-[6-[3-[(3-methylphenyl)methylcarbamoyloxy]prop-1-ynyl]-2-pyridinyl]prop-2-ynyl N-[(3-methylphenyl)methyl]carbamate.
| Compound Name | tert-butyl carbamate;3-[6-[3-[(3-methylphenyl)methylcarbamoyloxy]prop-1-ynyl]-2-pyridinyl]prop-2-ynyl N-[(3-methylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 22058391 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | tert-butyl carbamate;3-[6-[3-[(3-methylphenyl)methylcarbamoyloxy]prop-1-ynyl]-2-pyridinyl]prop-2-ynyl N-[(3-methylphenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(N)=O.Cc1cccc(CNC(=O)OCC#Cc2cccc(C#CCOC(=O)NCc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C29H27N3O4.C5H11NO2/c1-22-8-3-10-24(18-22)20-30-28(33)35-16-6-14-26-12-5-13-27(32-26)15-7-17-36-29(34)31-21-25-11-4-9-23(2)19-25;1-5(2,3)8-4(6)7/h3-5,8-13,18-19H,16-17,20-21H2,1-2H3,(H,30,33)(H,31,34);1-3H3,(H2,6,7) |
| InChIKey | NCQNIEICUWETJC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 141.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|