C23H24N2O7 — CID 10455915
2-[[2,4,6-trioxo-5-[(3-phenylmethoxyphenyl)methyl]-1,3-diazinan-1-yl]methoxy]ethyl acetate (PubChem CID 10455915) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 2-[[2,4,6-trioxo-5-[(3-phenylmethoxyphenyl)methyl]-1,3-diazinan-1-yl]methoxy]ethyl acetate.
| Compound Name | 2-[[2,4,6-trioxo-5-[(3-phenylmethoxyphenyl)methyl]-1,3-diazinan-1-yl]methoxy]ethyl acetate |
|---|---|
| PubChem CID | 10455915 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[[2,4,6-trioxo-5-[(3-phenylmethoxyphenyl)methyl]-1,3-diazinan-1-yl]methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCN1C(=O)NC(=O)C(Cc2cccc(OCc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C23H24N2O7/c1-16(26)31-11-10-30-15-25-22(28)20(21(27)24-23(25)29)13-18-8-5-9-19(12-18)32-14-17-6-3-2-4-7-17/h2-9,12,20H,10-11,13-15H2,1H3,(H,24,27,29) |
| InChIKey | LCCLZYUDQPJXCO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|