C18H17F3O3 — CID 25017856
1,1,1-trifluoro-5-(3-phenylmethoxyphenoxy)pentan-2-one (PubChem CID 25017856) has the molecular formula C18H17F3O3 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-(3-phenylmethoxyphenoxy)pentan-2-one.
| Compound Name | 1,1,1-trifluoro-5-(3-phenylmethoxyphenoxy)pentan-2-one |
|---|---|
| PubChem CID | 25017856 |
| Molecular Formula | C18H17F3O3 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 1,1,1-trifluoro-5-(3-phenylmethoxyphenoxy)pentan-2-one |
| SMILES | O=C(CCCOc1cccc(OCc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3O3/c19-18(20,21)17(22)10-5-11-23-15-8-4-9-16(12-15)24-13-14-6-2-1-3-7-14/h1-4,6-9,12H,5,10-11,13H2 |
| InChIKey | WMKREQVKDPZZNN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|