C22H25F2NO2 — CID 146723962
5,5-difluoro-5-(3-phenylmethoxyphenyl)-1-pyrrolidin-1-ylpentan-1-one (PubChem CID 146723962) has the molecular formula C22H25F2NO2 and a molecular weight of 373.44 g/mol. Its IUPAC name is 5,5-difluoro-5-(3-phenylmethoxyphenyl)-1-pyrrolidin-1-ylpentan-1-one.
| Compound Name | 5,5-difluoro-5-(3-phenylmethoxyphenyl)-1-pyrrolidin-1-ylpentan-1-one |
|---|---|
| PubChem CID | 146723962 |
| Molecular Formula | C22H25F2NO2 |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 5,5-difluoro-5-(3-phenylmethoxyphenyl)-1-pyrrolidin-1-ylpentan-1-one |
| SMILES | O=C(CCCC(F)(F)c1cccc(OCc2ccccc2)c1)N1CCCC1 |
| InChI | InChI=1S/C22H25F2NO2/c23-22(24,13-7-12-21(26)25-14-4-5-15-25)19-10-6-11-20(16-19)27-17-18-8-2-1-3-9-18/h1-3,6,8-11,16H,4-5,7,12-15,17H2 |
| InChIKey | RFNLPMPHHZLKPQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |