C16H26N4O3 — CID 4916937
3-butyl-2,6-dioxo-5-(2-piperidin-1-ium-1-ylethyliminomethyl)pyrimidin-4-olate (PubChem CID 4916937) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-butyl-2,6-dioxo-5-(2-piperidin-1-ium-1-ylethyliminomethyl)pyrimidin-4-olate.
| Compound Name | 3-butyl-2,6-dioxo-5-(2-piperidin-1-ium-1-ylethyliminomethyl)pyrimidin-4-olate |
|---|---|
| PubChem CID | 4916937 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-butyl-2,6-dioxo-5-(2-piperidin-1-ium-1-ylethyliminomethyl)pyrimidin-4-olate |
| SMILES | CCCCn1c([O-])c(/C=N/CC[NH+]2CCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H26N4O3/c1-2-3-10-20-15(22)13(14(21)18-16(20)23)12-17-7-11-19-8-5-4-6-9-19/h12,22H,2-11H2,1H3,(H,18,21,23)/b17-12+ |
| InChIKey | VRTYBUKZFXGVPR-SFQUDFHCSA-N |
| XLogP | -1.10 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|