C20H20N8O6 — CID 137273846
8-[(2Z)-2-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 137273846) has the molecular formula C20H20N8O6 and a molecular weight of 468.43 g/mol. Its IUPAC name is 8-[(2Z)-2-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 137273846 |
| Molecular Formula | C20H20N8O6 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 8-[(2Z)-2-[[6-hydroxy-1-(4-methoxyphenyl)-2,4-dioxopyrimidin-5-yl]methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | COc1ccc(-n2c(O)c(/C=N\Nc3nc4c(c(=O)n(C)c(=O)n4C)n3C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H20N8O6/c1-25-13-14(26(2)20(33)27(3)17(13)31)22-18(25)24-21-9-12-15(29)23-19(32)28(16(12)30)10-5-7-11(34-4)8-6-10/h5-9,30H,1-4H3,(H,22,24)(H,23,29,32)/b21-9- |
| InChIKey | JMHUUMGLGPCHST-NKVSQWTQSA-N |
| XLogP | -1.03 |
| TPSA | 170.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|