C17H22N8O5 — CID 135549620
8-[(2E)-2-[(1-tert-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 135549620) has the molecular formula C17H22N8O5 and a molecular weight of 418.41 g/mol. Its IUPAC name is 8-[(2E)-2-[(1-tert-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(1-tert-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 135549620 |
| Molecular Formula | C17H22N8O5 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 8-[(2E)-2-[(1-tert-butyl-6-hydroxy-2,4-dioxopyrimidin-5-yl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(N/N=C/c3c(O)n(C(C)(C)C)c(=O)[nH]c3=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C17H22N8O5/c1-17(2,3)25-12(27)8(11(26)20-15(25)29)7-18-21-14-19-10-9(22(14)4)13(28)24(6)16(30)23(10)5/h7,27H,1-6H3,(H,19,21)(H,20,26,29)/b18-7+ |
| InChIKey | SUOCEPHKLGGYSE-CNHKJKLMSA-N |
| XLogP | -1.27 |
| TPSA | 161.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|