C16H17IN6O4 — CID 137172465
8-[(2Z)-2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 137172465) has the molecular formula C16H17IN6O4 and a molecular weight of 484.25 g/mol. Its IUPAC name is 8-[(2Z)-2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 137172465 |
| Molecular Formula | C16H17IN6O4 |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 8-[(2Z)-2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]hydrazinyl]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | COc1cc(/C=N\Nc2nc3c(c(=O)n(C)c(=O)n3C)n2C)cc(I)c1O |
| InChI | InChI=1S/C16H17IN6O4/c1-21-11-13(22(2)16(26)23(3)14(11)25)19-15(21)20-18-7-8-5-9(17)12(24)10(6-8)27-4/h5-7,24H,1-4H3,(H,19,20)/b18-7- |
| InChIKey | YPUNCERJTRLUHC-WSVATBPTSA-N |
| XLogP | 0.74 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|