C16H18N6O3 — CID 3807859
7-ethyl-8-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 3807859) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 7-ethyl-8-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-ethyl-8-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3807859 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 7-ethyl-8-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCn1c(NN=Cc2cccc(O)c2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H18N6O3/c1-4-22-12-13(20(2)16(25)21(3)14(12)24)18-15(22)19-17-9-10-6-5-7-11(23)8-10/h5-9,23H,4H2,1-3H3,(H,18,19) |
| InChIKey | IIRMNOUMLYJUTH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|