C23H24N6O2 — CID 18291528
8-[(2E)-2-benzylidenehydrazinyl]-7-[(2,5-dimethylphenyl)methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 18291528) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 8-[(2E)-2-benzylidenehydrazinyl]-7-[(2,5-dimethylphenyl)methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[(2E)-2-benzylidenehydrazinyl]-7-[(2,5-dimethylphenyl)methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 18291528 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 8-[(2E)-2-benzylidenehydrazinyl]-7-[(2,5-dimethylphenyl)methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1ccc(C)c(Cn2c(N/N=C/c3ccccc3)nc3c2c(=O)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C23H24N6O2/c1-15-10-11-16(2)18(12-15)14-29-19-20(27(3)23(31)28(4)21(19)30)25-22(29)26-24-13-17-8-6-5-7-9-17/h5-13H,14H2,1-4H3,(H,25,26)/b24-13+ |
| InChIKey | NWADCEBDCFTLLN-ZMOGYAJESA-N |
| XLogP | 2.54 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|