C16H17N7O4 — CID 1418199
7-ethyl-1,3-dimethyl-8-[2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione (PubChem CID 1418199) has the molecular formula C16H17N7O4 and a molecular weight of 371.36 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethyl-8-[2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-ethyl-1,3-dimethyl-8-[2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 1418199 |
| Molecular Formula | C16H17N7O4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 7-ethyl-1,3-dimethyl-8-[2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
| SMILES | CCn1c(NN=Cc2ccc([N+](=O)[O-])cc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H17N7O4/c1-4-22-12-13(20(2)16(25)21(3)14(12)24)18-15(22)19-17-9-10-5-7-11(8-6-10)23(26)27/h5-9H,4H2,1-3H3,(H,18,19) |
| InChIKey | DIIQFMSZTIECHO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 129.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|